C17H23Cr- — CID 624342
chromium;cyclopenta-1,3-diene;1,2,3,4,5,6-hexamethylbenzene (PubChem CID 624342) has the molecular formula C17H23Cr- and a molecular weight of 279.37 g/mol. Its IUPAC name is chromium;cyclopenta-1,3-diene;1,2,3,4,5,6-hexamethylbenzene.
| Compound Name | chromium;cyclopenta-1,3-diene;1,2,3,4,5,6-hexamethylbenzene |
|---|---|
| PubChem CID | 624342 |
| Molecular Formula | C17H23Cr- |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | chromium;cyclopenta-1,3-diene;1,2,3,4,5,6-hexamethylbenzene |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.[Cr].c1cc[cH-]c1 |
| InChI | InChI=1S/C12H18.C5H5.Cr/c1-7-8(2)10(4)12(6)11(5)9(7)3;1-2-4-5-3-1;/h1-6H3;1-5H;/q;-1; |
| InChIKey | TYCFJPQGSYHNQT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|