C8H14Cl3V- — CID 173257139
1,2,5-trimethylcyclopenta-1,3-diene;vanadium;trihydrochloride (PubChem CID 173257139) has the molecular formula C8H14Cl3V- and a molecular weight of 267.50 g/mol. Its IUPAC name is 1,2,5-trimethylcyclopenta-1,3-diene;vanadium;trihydrochloride.
| Compound Name | 1,2,5-trimethylcyclopenta-1,3-diene;vanadium;trihydrochloride |
|---|---|
| PubChem CID | 173257139 |
| Molecular Formula | C8H14Cl3V- |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 1,2,5-trimethylcyclopenta-1,3-diene;vanadium;trihydrochloride |
| SMILES | Cc1cc[c-](C)c1C.Cl.Cl.Cl.[V] |
| InChI | InChI=1S/C8H11.3ClH.V/c1-6-4-5-7(2)8(6)3;;;;/h4-5H,1-3H3;3*1H;/q-1;;;; |
| InChIKey | IUCOALDDIYQRFO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|