C18H26Fe — CID 172702522
cyclopenta-1,3-diene;1,5-ditert-butylcyclopenta-1,3-diene;iron(2+) (PubChem CID 172702522) has the molecular formula C18H26Fe and a molecular weight of 298.25 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,5-ditert-butylcyclopenta-1,3-diene;iron(2+).
| Compound Name | cyclopenta-1,3-diene;1,5-ditert-butylcyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 172702522 |
| Molecular Formula | C18H26Fe |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | cyclopenta-1,3-diene;1,5-ditert-butylcyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)c1ccc[c-]1C(C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H21.C5H5.Fe/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;1-2-4-5-3-1;/h7-9H,1-6H3;1-5H;/q2*-1;+2 |
| InChIKey | DDPLPPBRBCSNCI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|