C19H20FeO — CID 167432972
cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylpropan-2-yloxybenzene;iron(2+) (PubChem CID 167432972) has the molecular formula C19H20FeO and a molecular weight of 320.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylpropan-2-yloxybenzene;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylpropan-2-yloxybenzene;iron(2+) |
|---|---|
| PubChem CID | 167432972 |
| Molecular Formula | C19H20FeO |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylpropan-2-yloxybenzene;iron(2+) |
| SMILES | CC(C)(Oc1ccccc1)[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C14H15O.C5H5.Fe/c1-14(2,12-8-6-7-9-12)15-13-10-4-3-5-11-13;1-2-4-5-3-1;/h3-11H,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | FLKAGSNKKOKCRN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|