C22H34Fe — CID 157446662
cyclopenta-1,3-diene;iron(2+);1,2,5-tritert-butylcyclopenta-1,3-diene (PubChem CID 157446662) has the molecular formula C22H34Fe and a molecular weight of 354.36 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);1,2,5-tritert-butylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;iron(2+);1,2,5-tritert-butylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 157446662 |
| Molecular Formula | C22H34Fe |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);1,2,5-tritert-butylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)c1cc[c-](C(C)(C)C)c1C(C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C17H29.C5H5.Fe/c1-15(2,3)12-10-11-13(16(4,5)6)14(12)17(7,8)9;1-2-4-5-3-1;/h10-11H,1-9H3;1-5H;/q2*-1;+2 |
| InChIKey | BSHOJFSSGZRFKT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|