C15H20Fe — CID 75059444
cyclopenta-1,3-diene;iron(2+);1-(2-methylbutan-2-yl)cyclopenta-1,3-diene (PubChem CID 75059444) has the molecular formula C15H20Fe and a molecular weight of 256.17 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);1-(2-methylbutan-2-yl)cyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;iron(2+);1-(2-methylbutan-2-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 75059444 |
| Molecular Formula | C15H20Fe |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);1-(2-methylbutan-2-yl)cyclopenta-1,3-diene |
| SMILES | CCC(C)(C)c1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H15.C5H5.Fe/c1-4-10(2,3)9-7-5-6-8-9;1-2-4-5-3-1;/h5-8H,4H2,1-3H3;1-5H;/q2*-1;+2 |
| InChIKey | LTWPJEXNQDDLLI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|