C14H18FeO3S — CID 161014391
tert-butyl cyclopenta-1,3-diene-1-sulfonate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 161014391) has the molecular formula C14H18FeO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is tert-butyl cyclopenta-1,3-diene-1-sulfonate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | tert-butyl cyclopenta-1,3-diene-1-sulfonate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 161014391 |
| Molecular Formula | C14H18FeO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | tert-butyl cyclopenta-1,3-diene-1-sulfonate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)OS(=O)(=O)c1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H13O3S.C5H5.Fe/c1-9(2,3)12-13(10,11)8-6-4-5-7-8;1-2-4-5-3-1;/h4-7H,1-3H3;1-5H;/q2*-1;+2 |
| InChIKey | TXNNKQRAQVEBRW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|