C13H12Fe — CID 160569837
cyclopenta-1,3-diene;iron(2+);1-prop-1-ynylcyclopenta-1,3-diene (PubChem CID 160569837) has the molecular formula C13H12Fe and a molecular weight of 224.08 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);1-prop-1-ynylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;iron(2+);1-prop-1-ynylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 160569837 |
| Molecular Formula | C13H12Fe |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);1-prop-1-ynylcyclopenta-1,3-diene |
| SMILES | CC#Cc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H7.C5H5.Fe/c1-2-5-8-6-3-4-7-8;1-2-4-5-3-1;/h3-4,6-7H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | RAKBOHJWKVAPKP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|