C23H16FeO2 — CID 157194079
cyclopenta-1,3-diene;3-cyclopenta-1,3-dien-1-yl-1-(2-hydroxynaphthalen-1-yl)prop-2-yn-1-one;iron(2+) (PubChem CID 157194079) has the molecular formula C23H16FeO2 and a molecular weight of 380.22 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3-cyclopenta-1,3-dien-1-yl-1-(2-hydroxynaphthalen-1-yl)prop-2-yn-1-one;iron(2+).
| Compound Name | cyclopenta-1,3-diene;3-cyclopenta-1,3-dien-1-yl-1-(2-hydroxynaphthalen-1-yl)prop-2-yn-1-one;iron(2+) |
|---|---|
| PubChem CID | 157194079 |
| Molecular Formula | C23H16FeO2 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | cyclopenta-1,3-diene;3-cyclopenta-1,3-dien-1-yl-1-(2-hydroxynaphthalen-1-yl)prop-2-yn-1-one;iron(2+) |
| SMILES | O=C(C#Cc1ccc[cH-]1)c1c(O)ccc2ccccc12.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C18H11O2.C5H5.Fe/c19-16(11-9-13-5-1-2-6-13)18-15-8-4-3-7-14(15)10-12-17(18)20;1-2-4-5-3-1;/h1-8,10,12,20H;1-5H;/q2*-1;+2 |
| InChIKey | AQANSRGACVRCGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|