About 1-iodonaphthalen-2-ol
1-iodonaphthalen-2-ol (PubChem CID 16250) has the molecular formula C10H7IO
and a molecular weight of 270.07 g/mol. Its IUPAC name is 1-iodonaphthalen-2-ol.
Molecular Properties
| Compound Name | 1-iodonaphthalen-2-ol |
| PubChem CID | 16250 |
| Molecular Formula | C10H7IO |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 1-iodonaphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1I |
| InChI | InChI=1S/C10H7IO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| InChIKey | JEVGGOSILOIIHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodonaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodonaphthalen-2-ol?
The IUPAC name of 1-iodonaphthalen-2-ol (CID 16250) is 1-iodonaphthalen-2-ol.
What is the SMILES notation for 1-iodonaphthalen-2-ol?
The canonical SMILES for 1-iodonaphthalen-2-ol is Oc1ccc2ccccc2c1I.
What is the InChIKey of 1-iodonaphthalen-2-ol?
The InChIKey is JEVGGOSILOIIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7IO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H.
What are the key properties of 1-iodonaphthalen-2-ol?
1-iodonaphthalen-2-ol has a molecular weight of 270.07 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodonaphthalen-2-ol is sourced from PubChem (CID 16250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).