About diethylamino 2-hydroxynaphthalene-1-carboxylate
diethylamino 2-hydroxynaphthalene-1-carboxylate (PubChem CID 22369256) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is diethylamino 2-hydroxynaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | diethylamino 2-hydroxynaphthalene-1-carboxylate |
| PubChem CID | 22369256 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | diethylamino 2-hydroxynaphthalene-1-carboxylate |
| SMILES | CCN(CC)OC(=O)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c1-3-16(4-2)19-15(18)14-12-8-6-5-7-11(12)9-10-13(14)17/h5-10,17H,3-4H2,1-2H3 |
| InChIKey | AMRYWKBHKDFATP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylamino 2-hydroxynaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylamino 2-hydroxynaphthalene-1-carboxylate?
The IUPAC name of diethylamino 2-hydroxynaphthalene-1-carboxylate (CID 22369256) is diethylamino 2-hydroxynaphthalene-1-carboxylate.
What is the SMILES notation for diethylamino 2-hydroxynaphthalene-1-carboxylate?
The canonical SMILES for diethylamino 2-hydroxynaphthalene-1-carboxylate is CCN(CC)OC(=O)c1c(O)ccc2ccccc12.
What is the InChIKey of diethylamino 2-hydroxynaphthalene-1-carboxylate?
The InChIKey is AMRYWKBHKDFATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-3-16(4-2)19-15(18)14-12-8-6-5-7-11(12)9-10-13(14)17/h5-10,17H,3-4H2,1-2H3.
What are the key properties of diethylamino 2-hydroxynaphthalene-1-carboxylate?
diethylamino 2-hydroxynaphthalene-1-carboxylate has a molecular weight of 259.31 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethylamino 2-hydroxynaphthalene-1-carboxylate is sourced from PubChem (CID 22369256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).