C15H13ClO8 — CID 67630986
2-hydroxy-3-(2-hydroxynaphthalene-1-carbonyl)oxybutanedioic acid;hydrochloride (PubChem CID 67630986) has the molecular formula C15H13ClO8 and a molecular weight of 356.71 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxynaphthalene-1-carbonyl)oxybutanedioic acid;hydrochloride.
| Compound Name | 2-hydroxy-3-(2-hydroxynaphthalene-1-carbonyl)oxybutanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 67630986 |
| Molecular Formula | C15H13ClO8 |
| Molecular Weight | 356.71 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxynaphthalene-1-carbonyl)oxybutanedioic acid;hydrochloride |
| SMILES | Cl.O=C(OC(C(=O)O)C(O)C(=O)O)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H12O8.ClH/c16-9-6-5-7-3-1-2-4-8(7)10(9)15(22)23-12(14(20)21)11(17)13(18)19;/h1-6,11-12,16-17H,(H,18,19)(H,20,21);1H |
| InChIKey | BEIIUXKWQOUTEA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |