C13H8Br- — CID 134857593
1-bromo-4-(2-cyclopenta-1,3-dien-1-ylethynyl)benzene (PubChem CID 134857593) has the molecular formula C13H8Br- and a molecular weight of 244.11 g/mol. Its IUPAC name is 1-bromo-4-(2-cyclopenta-1,3-dien-1-ylethynyl)benzene.
| Compound Name | 1-bromo-4-(2-cyclopenta-1,3-dien-1-ylethynyl)benzene |
|---|---|
| PubChem CID | 134857593 |
| Molecular Formula | C13H8Br- |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | 1-bromo-4-(2-cyclopenta-1,3-dien-1-ylethynyl)benzene |
| SMILES | Brc1ccc(C#Cc2ccc[cH-]2)cc1 |
| InChI | InChI=1S/C13H8Br/c14-13-9-7-12(8-10-13)6-5-11-3-1-2-4-11/h1-4,7-10H/q-1 |
| InChIKey | JUDNQASIAGPLAY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|