C13H17FeN — CID 172826783
cyclopenta-1,3-diene;iron(2+);N-propan-2-ylcyclopenta-1,3-dien-1-amine (PubChem CID 172826783) has the molecular formula C13H17FeN and a molecular weight of 243.13 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);N-propan-2-ylcyclopenta-1,3-dien-1-amine.
| Compound Name | cyclopenta-1,3-diene;iron(2+);N-propan-2-ylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 172826783 |
| Molecular Formula | C13H17FeN |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);N-propan-2-ylcyclopenta-1,3-dien-1-amine |
| SMILES | CC(C)Nc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H12N.C5H5.Fe/c1-7(2)9-8-5-3-4-6-8;1-2-4-5-3-1;/h3-7,9H,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | UYYYNEUNXDUWCN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|