C15H19FeNO2 — CID 44630163
tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 44630163) has the molecular formula C15H19FeNO2 and a molecular weight of 301.17 g/mol. Its IUPAC name is tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 44630163 |
| Molecular Formula | C15H19FeNO2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)OC(=O)Nc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C10H14NO2.C5H5.Fe/c1-10(2,3)13-9(12)11-8-6-4-5-7-8;1-2-4-5-3-1;/h4-7H,1-3H3,(H,11,12);1-5H;/q2*-1;+2 |
| InChIKey | JDCPJRGAIUXBOX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|