C11H14LiNO2 — CID 10560156
lithium tert-butyl (NZ)-N-(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-ylidenecarbamate (PubChem CID 10560156) has the molecular formula C11H14LiNO2 and a molecular weight of 205.13 g/mol. Its IUPAC name is lithium tert-butyl (NZ)-N-(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-ylidenecarbamate.
| Compound Name | lithium tert-butyl (NZ)-N-(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-ylidenecarbamate |
|---|---|
| PubChem CID | 10560156 |
| Molecular Formula | C11H14LiNO2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | lithium tert-butyl (NZ)-N-(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-ylidenecarbamate |
| SMILES | CC(C)(C)OC(=O)N=[13c]1[13cH][13cH][13cH][13cH][13cH-]1.[Li+] |
| InChI | InChI=1S/C11H14NO2.Li/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;/h4-8H,1-3H3;/q-1;+1/i4+1,5+1,6+1,7+1,8+1,9+1; |
| InChIKey | GFOOMUUVKKAYGP-FBTUAIPWSA-N |
| XLogP | -0.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|