C12H15ClN2O2 — CID 82482108
tert-butyl (NZ)-N-[amino-(2-chlorophenyl)methylidene]carbamate (PubChem CID 82482108) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-(2-chlorophenyl)methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[amino-(2-chlorophenyl)methylidene]carbamate |
|---|---|
| PubChem CID | 82482108 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-(2-chlorophenyl)methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\N)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O2/c1-12(2,3)17-11(16)15-10(14)8-6-4-5-7-9(8)13/h4-7H,1-3H3,(H2,14,15,16) |
| InChIKey | IQEGWKXQMKFALL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|