C20H28FeN2O4-2 — CID 175687815
bis(tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate);iron (PubChem CID 175687815) has the molecular formula C20H28FeN2O4-2 and a molecular weight of 416.30 g/mol. Its IUPAC name is bis(tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate);iron.
| Compound Name | bis(tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate);iron |
|---|---|
| PubChem CID | 175687815 |
| Molecular Formula | C20H28FeN2O4-2 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | bis(tert-butyl N-cyclopenta-1,3-dien-1-ylcarbamate);iron |
| SMILES | CC(C)(C)OC(=O)Nc1ccc[cH-]1.CC(C)(C)OC(=O)Nc1ccc[cH-]1.[Fe] |
| InChI | InChI=1S/2C10H14NO2.Fe/c2*1-10(2,3)13-9(12)11-8-6-4-5-7-8;/h2*4-7H,1-3H3,(H,11,12);/q2*-1; |
| InChIKey | LNNKCVRNODOIMQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|