C14H18Fe-6 — CID 173240986
5-ethyl-1-methylcyclopenta-1,3-diene;iron;methylcyclopentane (PubChem CID 173240986) has the molecular formula C14H18Fe-6 and a molecular weight of 242.14 g/mol. Its IUPAC name is 5-ethyl-1-methylcyclopenta-1,3-diene;iron;methylcyclopentane.
| Compound Name | 5-ethyl-1-methylcyclopenta-1,3-diene;iron;methylcyclopentane |
|---|---|
| PubChem CID | 173240986 |
| Molecular Formula | C14H18Fe-6 |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-ethyl-1-methylcyclopenta-1,3-diene;iron;methylcyclopentane |
| SMILES | CC[c-]1cccc1C.C[c-]1[cH-][cH-][cH-][cH-]1.[Fe] |
| InChI | InChI=1S/C8H11.C6H7.Fe/c1-3-8-6-4-5-7(8)2;1-6-4-2-3-5-6;/h4-6H,3H2,1-2H3;2-5H,1H3;/q-1;-5; |
| InChIKey | ZWRHJNGQFMZZOG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|