C20H30Fe-6 — CID 173240726
1,5-diethylcyclopenta-1,3-diene;iron;1,2,3-triethylcyclopentane (PubChem CID 173240726) has the molecular formula C20H30Fe-6 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1,5-diethylcyclopenta-1,3-diene;iron;1,2,3-triethylcyclopentane.
| Compound Name | 1,5-diethylcyclopenta-1,3-diene;iron;1,2,3-triethylcyclopentane |
|---|---|
| PubChem CID | 173240726 |
| Molecular Formula | C20H30Fe-6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1,5-diethylcyclopenta-1,3-diene;iron;1,2,3-triethylcyclopentane |
| SMILES | CC[c-]1[cH-][cH-][c-](CC)[c-]1CC.CCc1ccc[c-]1CC.[Fe] |
| InChI | InChI=1S/C11H17.C9H13.Fe/c1-4-9-7-8-10(5-2)11(9)6-3;1-3-8-6-5-7-9(8)4-2;/h7-8H,4-6H2,1-3H3;5-7H,3-4H2,1-2H3;/q-5;-1; |
| InChIKey | MXVGYPRQJOYVGY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|