C14H18Fe-6 — CID 173240550
1,5-dimethylcyclopenta-1,3-diene;1,2-dimethylcyclopentane;iron (PubChem CID 173240550) has the molecular formula C14H18Fe-6 and a molecular weight of 242.14 g/mol. Its IUPAC name is 1,5-dimethylcyclopenta-1,3-diene;1,2-dimethylcyclopentane;iron.
| Compound Name | 1,5-dimethylcyclopenta-1,3-diene;1,2-dimethylcyclopentane;iron |
|---|---|
| PubChem CID | 173240550 |
| Molecular Formula | C14H18Fe-6 |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1,5-dimethylcyclopenta-1,3-diene;1,2-dimethylcyclopentane;iron |
| SMILES | C[c-]1[cH-][cH-][cH-][c-]1C.Cc1ccc[c-]1C.[Fe] |
| InChI | InChI=1S/2C7H9.Fe/c2*1-6-4-3-5-7(6)2;/h2*3-5H,1-2H3;/q-5;-1; |
| InChIKey | MBHSHCXEVCJIQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|