C38H36FeP2-6 — CID 87186633
cyclopenta-2,4-dien-1-yl-bis(2-methylphenyl)phosphane;cyclopentyl-bis(2-methylphenyl)phosphane;iron (PubChem CID 87186633) has the molecular formula C38H36FeP2-6 and a molecular weight of 610.50 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-bis(2-methylphenyl)phosphane;cyclopentyl-bis(2-methylphenyl)phosphane;iron.
| Compound Name | cyclopenta-2,4-dien-1-yl-bis(2-methylphenyl)phosphane;cyclopentyl-bis(2-methylphenyl)phosphane;iron |
|---|---|
| PubChem CID | 87186633 |
| Molecular Formula | C38H36FeP2-6 |
| Molecular Weight | 610.50 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-bis(2-methylphenyl)phosphane;cyclopentyl-bis(2-methylphenyl)phosphane;iron |
| SMILES | Cc1ccccc1P(c1ccccc1C)[c-]1[cH-][cH-][cH-][cH-]1.Cc1ccccc1P(c1ccccc1C)[c-]1cccc1.[Fe] |
| InChI | InChI=1S/2C19H18P.Fe/c2*1-15-9-3-7-13-18(15)20(17-11-5-6-12-17)19-14-8-4-10-16(19)2;/h2*3-14H,1-2H3;/q-5;-1; |
| InChIKey | NVZLTHRHFVBHBQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|