C22H19PRu-6 — CID 174391548
cyclopenta-2,4-dien-1-yl(diphenyl)phosphane;cyclopentane;ruthenium (PubChem CID 174391548) has the molecular formula C22H19PRu-6 and a molecular weight of 415.44 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl(diphenyl)phosphane;cyclopentane;ruthenium.
| Compound Name | cyclopenta-2,4-dien-1-yl(diphenyl)phosphane;cyclopentane;ruthenium |
|---|---|
| PubChem CID | 174391548 |
| Molecular Formula | C22H19PRu-6 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl(diphenyl)phosphane;cyclopentane;ruthenium |
| SMILES | [Ru].[cH-]1[cH-][cH-][cH-][cH-]1.c1ccc(P(c2ccccc2)[c-]2cccc2)cc1 |
| InChI | InChI=1S/C17H14P.C5H5.Ru/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;1-2-4-5-3-1;/h1-14H;1-5H;/q-1;-5; |
| InChIKey | UUIKUUFDVGNCJS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|