C16H14V-6 — CID 173359125
cyclopenta-2,4-dien-1-ylbenzene;cyclopentane;vanadium (PubChem CID 173359125) has the molecular formula C16H14V-6 and a molecular weight of 257.23 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylbenzene;cyclopentane;vanadium.
| Compound Name | cyclopenta-2,4-dien-1-ylbenzene;cyclopentane;vanadium |
|---|---|
| PubChem CID | 173359125 |
| Molecular Formula | C16H14V-6 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylbenzene;cyclopentane;vanadium |
| SMILES | [V].[cH-]1[cH-][cH-][cH-][cH-]1.c1ccc(-[c-]2cccc2)cc1 |
| InChI | InChI=1S/C11H9.C5H5.V/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-2-4-5-3-1;/h1-9H;1-5H;/q-1;-5; |
| InChIKey | NIFYREBKGUCJMF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|