C29H23Fe2N-8 — CID 174876633
cyclopenta-1,3-diene;cyclopentane;2,3-di(cyclopenta-2,4-dien-1-yl)quinoline;iron (PubChem CID 174876633) has the molecular formula C29H23Fe2N-8 and a molecular weight of 497.20 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentane;2,3-di(cyclopenta-2,4-dien-1-yl)quinoline;iron.
| Compound Name | cyclopenta-1,3-diene;cyclopentane;2,3-di(cyclopenta-2,4-dien-1-yl)quinoline;iron |
|---|---|
| PubChem CID | 174876633 |
| Molecular Formula | C29H23Fe2N-8 |
| Molecular Weight | 497.20 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentane;2,3-di(cyclopenta-2,4-dien-1-yl)quinoline;iron |
| SMILES | [Fe].[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1.c1ccc2nc(-[c-]3cccc3)c(-[c-]3cccc3)cc2c1 |
| InChI | InChI=1S/C19H13N.2C5H5.2Fe/c1-2-8-14(7-1)17-13-16-11-5-6-12-18(16)20-19(17)15-9-3-4-10-15;2*1-2-4-5-3-1;;/h1-13H;2*1-5H;;/q-2;-5;-1;; |
| InChIKey | SOZYQSBUKQBYEJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.20 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|