About cadmium(2+);bis(3-methylquinoline-2-thiolate)
cadmium(2+);bis(3-methylquinoline-2-thiolate) (PubChem CID 162181468) has the molecular formula C20H16CdN2S2
and a molecular weight of 460.91 g/mol. Its IUPAC name is cadmium(2+);bis(3-methylquinoline-2-thiolate).
Molecular Properties
| Compound Name | cadmium(2+);bis(3-methylquinoline-2-thiolate) |
| PubChem CID | 162181468 |
| Molecular Formula | C20H16CdN2S2 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | cadmium(2+);bis(3-methylquinoline-2-thiolate) |
| SMILES | Cc1cc2ccccc2nc1[S-].Cc1cc2ccccc2nc1[S-].[Cd+2] |
| InChI | InChI=1S/2C10H9NS.Cd/c2*1-7-6-8-4-2-3-5-9(8)11-10(7)12;/h2*2-6H,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | ZPBUAYOCKGHATK-UHFFFAOYSA-L |
| XLogP | 4.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis(3-methylquinoline-2-thiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(3-methylquinoline-2-thiolate)?
The IUPAC name of cadmium(2+);bis(3-methylquinoline-2-thiolate) (CID 162181468) is cadmium(2+);bis(3-methylquinoline-2-thiolate).
What is the SMILES notation for cadmium(2+);bis(3-methylquinoline-2-thiolate)?
The canonical SMILES for cadmium(2+);bis(3-methylquinoline-2-thiolate) is Cc1cc2ccccc2nc1[S-].Cc1cc2ccccc2nc1[S-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(3-methylquinoline-2-thiolate)?
The InChIKey is ZPBUAYOCKGHATK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H9NS.Cd/c2*1-7-6-8-4-2-3-5-9(8)11-10(7)12;/h2*2-6H,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(3-methylquinoline-2-thiolate)?
cadmium(2+);bis(3-methylquinoline-2-thiolate) has a molecular weight of 460.91 g/mol, XLogP of 4.90, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(3-methylquinoline-2-thiolate) is sourced from PubChem (CID 162181468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).