About (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron
(1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron (PubChem CID 175496162) has the molecular formula C24H20Fe-6
and a molecular weight of 364.27 g/mol. Its IUPAC name is (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron.
Molecular Properties
| Compound Name | (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron |
| PubChem CID | 175496162 |
| Molecular Formula | C24H20Fe-6 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron |
| SMILES | C(=C(c1ccccc1)[c-]1cccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H15.C5H5.Fe/c1-3-9-16(10-4-1)15-19(18-13-7-8-14-18)17-11-5-2-6-12-17;1-2-4-5-3-1;/h1-15H;1-5H;/q-1;-5; |
| InChIKey | ZXMOCBCNTHRJMU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron?
The IUPAC name of (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron (CID 175496162) is (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron.
What is the SMILES notation for (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron?
The canonical SMILES for (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron is C(=C(c1ccccc1)[c-]1cccc1)c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron?
The InChIKey is ZXMOCBCNTHRJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.C5H5.Fe/c1-3-9-16(10-4-1)15-19(18-13-7-8-14-18)17-11-5-2-6-12-17;1-2-4-5-3-1;/h1-15H;1-5H;/q-1;-5;.
What are the key properties of (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron?
(1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron has a molecular weight of 364.27 g/mol, XLogP of 6.40, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopenta-2,4-dien-1-yl-2-phenylethenyl)benzene;cyclopentane;iron is sourced from PubChem (CID 175496162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).