C14H19CoP-6 — CID 174798718
cobalt;cyclopenta-2,4-dien-1-yl(diethyl)phosphane;cyclopentane (PubChem CID 174798718) has the molecular formula C14H19CoP-6 and a molecular weight of 277.21 g/mol. Its IUPAC name is cobalt;cyclopenta-2,4-dien-1-yl(diethyl)phosphane;cyclopentane.
| Compound Name | cobalt;cyclopenta-2,4-dien-1-yl(diethyl)phosphane;cyclopentane |
|---|---|
| PubChem CID | 174798718 |
| Molecular Formula | C14H19CoP-6 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | cobalt;cyclopenta-2,4-dien-1-yl(diethyl)phosphane;cyclopentane |
| SMILES | CCP(CC)[c-]1cccc1.[Co].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H14P.C5H5.Co/c1-3-10(4-2)9-7-5-6-8-9;1-2-4-5-3-1;/h5-8H,3-4H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | HQWIXFFGEYLUEH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|