C18H28FeP2 — CID 15913634
bis(cyclopenta-2,4-dien-1-yl(diethyl)phosphane);iron(2+) (PubChem CID 15913634) has the molecular formula C18H28FeP2 and a molecular weight of 362.22 g/mol. Its IUPAC name is bis(cyclopenta-2,4-dien-1-yl(diethyl)phosphane);iron(2+).
| Compound Name | bis(cyclopenta-2,4-dien-1-yl(diethyl)phosphane);iron(2+) |
|---|---|
| PubChem CID | 15913634 |
| Molecular Formula | C18H28FeP2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | bis(cyclopenta-2,4-dien-1-yl(diethyl)phosphane);iron(2+) |
| SMILES | CCP(CC)[c-]1cccc1.CCP(CC)[c-]1cccc1.[Fe+2] |
| InChI | InChI=1S/2C9H14P.Fe/c2*1-3-10(4-2)9-7-5-6-8-9;/h2*5-8H,3-4H2,1-2H3;/q2*-1;+2 |
| InChIKey | BCPVFKXAPLQYIE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|