C24H40FeN2-6 — CID 174059779
N-[1-[2-[1-(tert-butylamino)propyl]cyclopenta-2,4-dien-1-yl]propyl]-2-methylpropan-2-amine;cyclopentane;iron (PubChem CID 174059779) has the molecular formula C24H40FeN2-6 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[1-[2-[1-(tert-butylamino)propyl]cyclopenta-2,4-dien-1-yl]propyl]-2-methylpropan-2-amine;cyclopentane;iron.
| Compound Name | N-[1-[2-[1-(tert-butylamino)propyl]cyclopenta-2,4-dien-1-yl]propyl]-2-methylpropan-2-amine;cyclopentane;iron |
|---|---|
| PubChem CID | 174059779 |
| Molecular Formula | C24H40FeN2-6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-[1-[2-[1-(tert-butylamino)propyl]cyclopenta-2,4-dien-1-yl]propyl]-2-methylpropan-2-amine;cyclopentane;iron |
| SMILES | CCC(NC(C)(C)C)c1ccc[c-]1C(CC)NC(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H35N2.C5H5.Fe/c1-9-16(20-18(3,4)5)14-12-11-13-15(14)17(10-2)21-19(6,7)8;1-2-4-5-3-1;/h11-13,16-17,20-21H,9-10H2,1-8H3;1-5H;/q-1;-5; |
| InChIKey | KVHCSNHIZAIURQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|