C31H38FeP2-6 — CID 87228497
cyclopentane;ditert-butyl-[2-(diphenylphosphanylmethyl)cyclopenta-2,4-dien-1-yl]phosphane;iron (PubChem CID 87228497) has the molecular formula C31H38FeP2-6 and a molecular weight of 528.44 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-[2-(diphenylphosphanylmethyl)cyclopenta-2,4-dien-1-yl]phosphane;iron.
| Compound Name | cyclopentane;ditert-butyl-[2-(diphenylphosphanylmethyl)cyclopenta-2,4-dien-1-yl]phosphane;iron |
|---|---|
| PubChem CID | 87228497 |
| Molecular Formula | C31H38FeP2-6 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | cyclopentane;ditert-butyl-[2-(diphenylphosphanylmethyl)cyclopenta-2,4-dien-1-yl]phosphane;iron |
| SMILES | CC(C)(C)P([c-]1cccc1CP(c1ccccc1)c1ccccc1)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C26H33P2.C5H5.Fe/c1-25(2,3)28(26(4,5)6)24-19-13-14-21(24)20-27(22-15-9-7-10-16-22)23-17-11-8-12-18-23;1-2-4-5-3-1;/h7-19H,20H2,1-6H3;1-5H;/q-1;-5; |
| InChIKey | XKNVAJMYOSTMCH-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|