C36H48FeP2-6 — CID 87241709
[5-[bis(2-methylbutan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron (PubChem CID 87241709) has the molecular formula C36H48FeP2-6 and a molecular weight of 598.57 g/mol. Its IUPAC name is [5-[bis(2-methylbutan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron.
| Compound Name | [5-[bis(2-methylbutan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron |
|---|---|
| PubChem CID | 87241709 |
| Molecular Formula | C36H48FeP2-6 |
| Molecular Weight | 598.57 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [5-[bis(2-methylbutan-2-yl)phosphanylmethyl]cyclopenta-1,3-dien-1-yl]methyl-bis(2-methylphenyl)phosphane;cyclopentane;iron |
| SMILES | CCC(C)(C)P(C[c-]1cccc1CP(c1ccccc1C)c1ccccc1C)C(C)(C)CC.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C31H43P2.C5H5.Fe/c1-9-30(5,6)33(31(7,8)10-2)23-27-19-15-18-26(27)22-32(28-20-13-11-16-24(28)3)29-21-14-12-17-25(29)4;1-2-4-5-3-1;/h11-21H,9-10,22-23H2,1-8H3;1-5H;/q-1;-5; |
| InChIKey | RNAQWTYEQYZIAV-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.57 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|