C25H33FeP-6 — CID 175050739
cyclopentane;ditert-butyl-[(3-phenylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron (PubChem CID 175050739) has the molecular formula C25H33FeP-6 and a molecular weight of 420.36 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-[(3-phenylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron.
| Compound Name | cyclopentane;ditert-butyl-[(3-phenylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron |
|---|---|
| PubChem CID | 175050739 |
| Molecular Formula | C25H33FeP-6 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | cyclopentane;ditert-butyl-[(3-phenylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron |
| SMILES | CC(C)(C)P(C[c-]1ccc(-c2ccccc2)c1)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C20H28P.C5H5.Fe/c1-19(2,3)21(20(4,5)6)15-16-12-13-18(14-16)17-10-8-7-9-11-17;1-2-4-5-3-1;/h7-14H,15H2,1-6H3;1-5H;/q-1;-5; |
| InChIKey | VRIQVFSMRMOZJL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|