About cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron
cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron (PubChem CID 174647542) has the molecular formula C24H31FeP-6
and a molecular weight of 406.33 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron.
Molecular Properties
| Compound Name | cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron |
| PubChem CID | 174647542 |
| Molecular Formula | C24H31FeP-6 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron |
| SMILES | CC(C)(C)P([c-]1cccc1-c1ccccc1)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H26P.C5H5.Fe/c1-18(2,3)20(19(4,5)6)17-14-10-13-16(17)15-11-8-7-9-12-15;1-2-4-5-3-1;/h7-14H,1-6H3;1-5H;/q-1;-5; |
| InChIKey | QSVUBJXTRNQFPN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron?
The IUPAC name of cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron (CID 174647542) is cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron.
What is the SMILES notation for cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron?
The canonical SMILES for cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron is CC(C)(C)P([c-]1cccc1-c1ccccc1)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron?
The InChIKey is QSVUBJXTRNQFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26P.C5H5.Fe/c1-18(2,3)20(19(4,5)6)17-14-10-13-16(17)15-11-8-7-9-12-15;1-2-4-5-3-1;/h7-14H,1-6H3;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron?
cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron has a molecular weight of 406.33 g/mol, XLogP of 7.18, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;ditert-butyl-(2-phenylcyclopenta-2,4-dien-1-yl)phosphane;iron is sourced from PubChem (CID 174647542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).