C48H47FeP — CID 140945770
cyclopenta-2,4-dien-1-ylbenzene;ditert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) (PubChem CID 140945770) has the molecular formula C48H47FeP and a molecular weight of 710.72 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylbenzene;ditert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+).
| Compound Name | cyclopenta-2,4-dien-1-ylbenzene;ditert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
|---|---|
| PubChem CID | 140945770 |
| Molecular Formula | C48H47FeP |
| Molecular Weight | 710.72 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylbenzene;ditert-butyl-(2,3,4,5-tetraphenylcyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
| SMILES | CC(C)(C)P([c-]1c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1)C(C)(C)C.[Fe+2].c1ccc(-[c-]2cccc2)cc1 |
| InChI | InChI=1S/C37H38P.C11H9.Fe/c1-36(2,3)38(37(4,5)6)35-33(29-23-15-9-16-24-29)31(27-19-11-7-12-20-27)32(28-21-13-8-14-22-28)34(35)30-25-17-10-18-26-30;1-2-6-10(7-3-1)11-8-4-5-9-11;/h7-26H,1-6H3;1-9H;/q2*-1;+2 |
| InChIKey | CUMSJRLTCQAEMH-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.72 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|