C22H15O2Rh- — CID 162398279
rhodium;3,4,5-triphenylfuran-5-id-2-one (PubChem CID 162398279) has the molecular formula C22H15O2Rh- and a molecular weight of 414.27 g/mol. Its IUPAC name is rhodium;3,4,5-triphenylfuran-5-id-2-one.
| Compound Name | rhodium;3,4,5-triphenylfuran-5-id-2-one |
|---|---|
| PubChem CID | 162398279 |
| Molecular Formula | C22H15O2Rh- |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | rhodium;3,4,5-triphenylfuran-5-id-2-one |
| SMILES | O=c1o[c-](-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.[Rh] |
| InChI | InChI=1S/C22H15O2.Rh/c23-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(24-22)18-14-8-3-9-15-18;/h1-15H;/q-1; |
| InChIKey | YBOAHDWGBKFDTR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|