C19H16O4 — CID 12006528
2,6-bis(hydroxymethyl)-3,5-diphenylpyran-4-one (PubChem CID 12006528) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)-3,5-diphenylpyran-4-one.
| Compound Name | 2,6-bis(hydroxymethyl)-3,5-diphenylpyran-4-one |
|---|---|
| PubChem CID | 12006528 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2,6-bis(hydroxymethyl)-3,5-diphenylpyran-4-one |
| SMILES | O=c1c(-c2ccccc2)c(CO)oc(CO)c1-c1ccccc1 |
| InChI | InChI=1S/C19H16O4/c20-11-15-17(13-7-3-1-4-8-13)19(22)18(16(12-21)23-15)14-9-5-2-6-10-14/h1-10,20-21H,11-12H2 |
| InChIKey | CVISGXYQWNLKMU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |