C20H21NO5 — CID 141266658
1-[5-[5-hydroxy-3-(hydroxymethyl)-4-phenylfuran-2-yl]pentyl]pyrrole-2,5-dione (PubChem CID 141266658) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[5-[5-hydroxy-3-(hydroxymethyl)-4-phenylfuran-2-yl]pentyl]pyrrole-2,5-dione.
| Compound Name | 1-[5-[5-hydroxy-3-(hydroxymethyl)-4-phenylfuran-2-yl]pentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141266658 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[5-[5-hydroxy-3-(hydroxymethyl)-4-phenylfuran-2-yl]pentyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCc1oc(O)c(-c2ccccc2)c1CO |
| InChI | InChI=1S/C20H21NO5/c22-13-15-16(26-20(25)19(15)14-7-3-1-4-8-14)9-5-2-6-12-21-17(23)10-11-18(21)24/h1,3-4,7-8,10-11,22,25H,2,5-6,9,12-13H2 |
| InChIKey | YZELRZVTJJJVME-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|