C17H29NO2S — CID 173127544
1-(13-sulfanyltridecyl)pyrrole-2,5-dione (PubChem CID 173127544) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 1-(13-sulfanyltridecyl)pyrrole-2,5-dione.
| Compound Name | 1-(13-sulfanyltridecyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 173127544 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(13-sulfanyltridecyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCCCCCCCCCS |
| InChI | InChI=1S/C17H29NO2S/c19-16-12-13-17(20)18(16)14-10-8-6-4-2-1-3-5-7-9-11-15-21/h12-13,21H,1-11,14-15H2 |
| InChIKey | JCMLNGKIKQGRCH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|