About 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate
4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate (PubChem CID 139913201) has the molecular formula C14H15NO5S
and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate |
| PubChem CID | 139913201 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate |
| SMILES | O=C1C=CC(=O)N1CCCCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO5S/c16-13-8-9-14(17)15(13)10-4-5-11-20-21(18,19)12-6-2-1-3-7-12/h1-3,6-9H,4-5,10-11H2 |
| InChIKey | ZIYFHEMZFKJLSA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate?
The IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate (CID 139913201) is 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate.
What is the SMILES notation for 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate?
The canonical SMILES for 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate is O=C1C=CC(=O)N1CCCCOS(=O)(=O)c1ccccc1.
What is the InChIKey of 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate?
The InChIKey is ZIYFHEMZFKJLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO5S/c16-13-8-9-14(17)15(13)10-4-5-11-20-21(18,19)12-6-2-1-3-7-12/h1-3,6-9H,4-5,10-11H2.
What are the key properties of 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate?
4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate has a molecular weight of 309.34 g/mol, XLogP of 1.10, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrol-1-yl)butyl benzenesulfonate is sourced from PubChem (CID 139913201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).