About [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol
[5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol (PubChem CID 13177160) has the molecular formula C18H16O2S
and a molecular weight of 296.39 g/mol. Its IUPAC name is [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol |
| PubChem CID | 13177160 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol |
| SMILES | OCc1sc(CO)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H16O2S/c19-11-15-17(13-7-3-1-4-8-13)18(16(12-20)21-15)14-9-5-2-6-10-14/h1-10,19-20H,11-12H2 |
| InChIKey | VAWXXLUUIZQEID-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol (CID 13177160) is [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol is OCc1sc(CO)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol?
The InChIKey is VAWXXLUUIZQEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O2S/c19-11-15-17(13-7-3-1-4-8-13)18(16(12-20)21-15)14-9-5-2-6-10-14/h1-10,19-20H,11-12H2.
What are the key properties of [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol?
[5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol has a molecular weight of 296.39 g/mol, XLogP of 4.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-3,4-diphenylthiophen-2-yl]methanol is sourced from PubChem (CID 13177160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).