C32H14O6 — CID 56632747
7,17-diphenyl-4,14-dioxahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11(22),12(16),17,19-octaene-3,5,13,15-tetrone (PubChem CID 56632747) has the molecular formula C32H14O6 and a molecular weight of 494.46 g/mol. Its IUPAC name is 7,17-diphenyl-4,14-dioxahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11(22),12(16),17,19-octaene-3,5,13,15-tetrone.
| Compound Name | 7,17-diphenyl-4,14-dioxahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11(22),12(16),17,19-octaene-3,5,13,15-tetrone |
|---|---|
| PubChem CID | 56632747 |
| Molecular Formula | C32H14O6 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 7,17-diphenyl-4,14-dioxahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2(6),7,9,11(22),12(16),17,19-octaene-3,5,13,15-tetrone |
| SMILES | O=c1oc(=O)c2c1c(-c1ccccc1)c1ccc3c4c(=O)oc(=O)c4c(-c4ccccc4)c4ccc2c1c43 |
| InChI | InChI=1S/C32H14O6/c33-29-25-19-14-12-18-22(16-9-5-2-6-10-16)28-26(30(34)38-32(28)36)20-13-11-17(23(19)24(18)20)21(27(25)31(35)37-29)15-7-3-1-4-8-15/h1-14H |
| InChIKey | ZJKKBHVBJCNGII-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|