C24H8O6 — CID 56622055
4,9-dioxaheptacyclo[12.10.2.02,6.07,26.011,16.015,20.021,25]hexacosa-1(24),2(6),7(26),11,13,15(20),16,18,21(25),22-decaene-3,5,8,10-tetrone (PubChem CID 56622055) has the molecular formula C24H8O6 and a molecular weight of 392.32 g/mol. Its IUPAC name is 4,9-dioxaheptacyclo[12.10.2.02,6.07,26.011,16.015,20.021,25]hexacosa-1(24),2(6),7(26),11,13,15(20),16,18,21(25),22-decaene-3,5,8,10-tetrone.
| Compound Name | 4,9-dioxaheptacyclo[12.10.2.02,6.07,26.011,16.015,20.021,25]hexacosa-1(24),2(6),7(26),11,13,15(20),16,18,21(25),22-decaene-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 56622055 |
| Molecular Formula | C24H8O6 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 4,9-dioxaheptacyclo[12.10.2.02,6.07,26.011,16.015,20.021,25]hexacosa-1(24),2(6),7(26),11,13,15(20),16,18,21(25),22-decaene-3,5,8,10-tetrone |
| SMILES | O=c1oc(=O)c2c3c(=O)oc(=O)c3c3cccc4c5cccc6c1ccc(c65)c2c43 |
| InChI | InChI=1S/C24H8O6/c25-21-12-7-8-14-15-9(3-1-5-11(12)15)10-4-2-6-13-16(10)17(14)19(23(27)29-21)20-18(13)22(26)30-24(20)28/h1-8H |
| InChIKey | CTEQBXBONPMABN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|