C24H8Na2O6 — CID 132609901
disodium;8,19-dioxo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4(9),5,10,13(23),14,16,20(24),21,25-undecaene-6,17-diolate (PubChem CID 132609901) has the molecular formula C24H8Na2O6 and a molecular weight of 438.30 g/mol. Its IUPAC name is disodium;8,19-dioxo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4(9),5,10,13(23),14,16,20(24),21,25-undecaene-6,17-diolate.
| Compound Name | disodium;8,19-dioxo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4(9),5,10,13(23),14,16,20(24),21,25-undecaene-6,17-diolate |
|---|---|
| PubChem CID | 132609901 |
| Molecular Formula | C24H8Na2O6 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | disodium;8,19-dioxo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4(9),5,10,13(23),14,16,20(24),21,25-undecaene-6,17-diolate |
| SMILES | O=c1oc([O-])c2ccc3c4ccc5c(=O)oc([O-])c6ccc(c7ccc1c2c37)c4c65.[Na+].[Na+] |
| InChI | InChI=1S/C24H10O6.2Na/c25-21-13-5-1-9-10-2-6-15-20-16(24(28)30-23(15)27)8-4-12(18(10)20)11-3-7-14(22(26)29-21)19(13)17(9)11;;/h1-8,25,28H;;/q;2*+1/p-2 |
| InChIKey | HETIRUHDBFQEBR-UHFFFAOYSA-L |
| XLogP | -2.46 |
| TPSA | 106.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|