C23H37FeP-6 — CID 87567100
cyclopentane;ditert-butyl-[(2-tert-butylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron (PubChem CID 87567100) has the molecular formula C23H37FeP-6 and a molecular weight of 400.37 g/mol. Its IUPAC name is cyclopentane;ditert-butyl-[(2-tert-butylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron.
| Compound Name | cyclopentane;ditert-butyl-[(2-tert-butylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron |
|---|---|
| PubChem CID | 87567100 |
| Molecular Formula | C23H37FeP-6 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | cyclopentane;ditert-butyl-[(2-tert-butylcyclopenta-2,4-dien-1-yl)methyl]phosphane;iron |
| SMILES | CC(C)(C)c1ccc[c-]1CP(C(C)(C)C)C(C)(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C18H32P.C5H5.Fe/c1-16(2,3)15-12-10-11-14(15)13-19(17(4,5)6)18(7,8)9;1-2-4-5-3-1;/h10-12H,13H2,1-9H3;1-5H;/q-1;-5; |
| InChIKey | SREDFVLEOOFZNR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|