C14H20P2Zr-6 — CID 90111305
cyclopentane;(2-dimethylphosphanylcyclopenta-2,4-dien-1-yl)-dimethylphosphane;zirconium (PubChem CID 90111305) has the molecular formula C14H20P2Zr-6 and a molecular weight of 341.49 g/mol. Its IUPAC name is cyclopentane;(2-dimethylphosphanylcyclopenta-2,4-dien-1-yl)-dimethylphosphane;zirconium.
| Compound Name | cyclopentane;(2-dimethylphosphanylcyclopenta-2,4-dien-1-yl)-dimethylphosphane;zirconium |
|---|---|
| PubChem CID | 90111305 |
| Molecular Formula | C14H20P2Zr-6 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | cyclopentane;(2-dimethylphosphanylcyclopenta-2,4-dien-1-yl)-dimethylphosphane;zirconium |
| SMILES | CP(C)c1ccc[c-]1P(C)C.[Zr].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H15P2.C5H5.Zr/c1-10(2)8-6-5-7-9(8)11(3)4;1-2-4-5-3-1;/h5-7H,1-4H3;1-5H;/q-1;-5; |
| InChIKey | OUPRYQTXLUDRBG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|