C42H76P2Ti-6 — CID 90109233
cyclopentane;(2-dioctylphosphanylcyclopenta-2,4-dien-1-yl)-dioctylphosphane;titanium (PubChem CID 90109233) has the molecular formula C42H76P2Ti-6 and a molecular weight of 690.89 g/mol. Its IUPAC name is cyclopentane;(2-dioctylphosphanylcyclopenta-2,4-dien-1-yl)-dioctylphosphane;titanium.
| Compound Name | cyclopentane;(2-dioctylphosphanylcyclopenta-2,4-dien-1-yl)-dioctylphosphane;titanium |
|---|---|
| PubChem CID | 90109233 |
| Molecular Formula | C42H76P2Ti-6 |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.49 |
| IUPAC Name | cyclopentane;(2-dioctylphosphanylcyclopenta-2,4-dien-1-yl)-dioctylphosphane;titanium |
| SMILES | CCCCCCCCP(CCCCCCCC)c1ccc[c-]1P(CCCCCCCC)CCCCCCCC.[Ti].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C37H71P2.C5H5.Ti/c1-5-9-13-17-21-25-32-38(33-26-22-18-14-10-6-2)36-30-29-31-37(36)39(34-27-23-19-15-11-7-3)35-28-24-20-16-12-8-4;1-2-4-5-3-1;/h29-31H,5-28,32-35H2,1-4H3;1-5H;/q-1;-5; |
| InChIKey | QIJRMRSEIZELBS-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|