About 1-heptylphosphol-2-amine
1-heptylphosphol-2-amine (PubChem CID 173085045) has the molecular formula C11H20NP
and a molecular weight of 197.26 g/mol. Its IUPAC name is 1-heptylphosphol-2-amine.
Molecular Properties
| Compound Name | 1-heptylphosphol-2-amine |
| PubChem CID | 173085045 |
| Molecular Formula | C11H20NP |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 1-heptylphosphol-2-amine |
| SMILES | CCCCCCCp1cccc1N |
| InChI | InChI=1S/C11H20NP/c1-2-3-4-5-6-9-13-10-7-8-11(13)12/h7-8,10H,2-6,9,12H2,1H3 |
| InChIKey | LWCFUVMQURFPAF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptylphosphol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptylphosphol-2-amine?
The IUPAC name of 1-heptylphosphol-2-amine (CID 173085045) is 1-heptylphosphol-2-amine.
What is the SMILES notation for 1-heptylphosphol-2-amine?
The canonical SMILES for 1-heptylphosphol-2-amine is CCCCCCCp1cccc1N.
What is the InChIKey of 1-heptylphosphol-2-amine?
The InChIKey is LWCFUVMQURFPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NP/c1-2-3-4-5-6-9-13-10-7-8-11(13)12/h7-8,10H,2-6,9,12H2,1H3.
What are the key properties of 1-heptylphosphol-2-amine?
1-heptylphosphol-2-amine has a molecular weight of 197.26 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptylphosphol-2-amine is sourced from PubChem (CID 173085045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).