C25H37FeOP-6 — CID 87987241
cyclopentane;dicyclohexyl-[5-(1-methoxyethyl)cyclopenta-1,3-dien-1-yl]phosphane;iron (PubChem CID 87987241) has the molecular formula C25H37FeOP-6 and a molecular weight of 440.39 g/mol. Its IUPAC name is cyclopentane;dicyclohexyl-[5-(1-methoxyethyl)cyclopenta-1,3-dien-1-yl]phosphane;iron.
| Compound Name | cyclopentane;dicyclohexyl-[5-(1-methoxyethyl)cyclopenta-1,3-dien-1-yl]phosphane;iron |
|---|---|
| PubChem CID | 87987241 |
| Molecular Formula | C25H37FeOP-6 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | cyclopentane;dicyclohexyl-[5-(1-methoxyethyl)cyclopenta-1,3-dien-1-yl]phosphane;iron |
| SMILES | COC(C)[c-]1cccc1P(C1CCCCC1)C1CCCCC1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C20H32OP.C5H5.Fe/c1-16(21-2)19-14-9-15-20(19)22(17-10-5-3-6-11-17)18-12-7-4-8-13-18;1-2-4-5-3-1;/h9,14-18H,3-8,10-13H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | FBENXWNYPDEQMO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|