C37H51O2P2- — CID 135085441
[(1R)-1-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopenta-2,4-dien-1-yl]ethyl]-dicyclohexylphosphane (PubChem CID 135085441) has the molecular formula C37H51O2P2- and a molecular weight of 589.76 g/mol. Its IUPAC name is [(1R)-1-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopenta-2,4-dien-1-yl]ethyl]-dicyclohexylphosphane.
| Compound Name | [(1R)-1-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopenta-2,4-dien-1-yl]ethyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 135085441 |
| Molecular Formula | C37H51O2P2- |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | [(1R)-1-[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopenta-2,4-dien-1-yl]ethyl]-dicyclohexylphosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2ccc[c-]2[C@@H](C)P(C2CCCCC2)C2CCCCC2)cc1C |
| InChI | InChI=1S/C37H51O2P2/c1-25-21-32(22-26(2)36(25)38-6)41(33-23-27(3)37(39-7)28(4)24-33)35-20-14-19-34(35)29(5)40(30-15-10-8-11-16-30)31-17-12-9-13-18-31/h14,19-24,29-31H,8-13,15-18H2,1-7H3/q-1/t29-/m1/s1 |
| InChIKey | SXAUTFMKPORSHG-GDLZYMKVSA-N |
| XLogP | 9.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|